About (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one
(2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one (PubChem CID 125483296) has the molecular formula C15H12F2O3
and a molecular weight of 278.25 g/mol. Its IUPAC name is (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one.
Molecular Properties
| Compound Name | (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one |
| PubChem CID | 125483296 |
| Molecular Formula | C15H12F2O3 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one |
| SMILES | O=C(c1ccc(F)cc1)[C@](O)(CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12F2O3/c16-12-5-1-10(2-6-12)14(19)15(20,9-18)11-3-7-13(17)8-4-11/h1-8,18,20H,9H2/t15-/m0/s1 |
| InChIKey | PPRYTBFVNQXABW-HNNXBMFYSA-N |
| XLogP | 2.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one?
The IUPAC name of (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one (CID 125483296) is (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one.
What is the SMILES notation for (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one?
The canonical SMILES for (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one is O=C(c1ccc(F)cc1)[C@](O)(CO)c1ccc(F)cc1.
What is the InChIKey of (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one?
The InChIKey is PPRYTBFVNQXABW-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H12F2O3/c16-12-5-1-10(2-6-12)14(19)15(20,9-18)11-3-7-13(17)8-4-11/h1-8,18,20H,9H2/t15-/m0/s1.
What are the key properties of (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one?
(2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one has a molecular weight of 278.25 g/mol, XLogP of 2.03, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one is sourced from PubChem (CID 125483296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).