C15H12F2O3 — CID 125483296
(2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one (PubChem CID 125483296) has the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. Its IUPAC name is (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one.
| Compound Name | (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one |
|---|---|
| PubChem CID | 125483296 |
| Molecular Formula | C15H12F2O3 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (2R)-1,2-bis(4-fluorophenyl)-2,3-dihydroxypropan-1-one |
| SMILES | O=C(c1ccc(F)cc1)[C@](O)(CO)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H12F2O3/c16-12-5-1-10(2-6-12)14(19)15(20,9-18)11-3-7-13(17)8-4-11/h1-8,18,20H,9H2/t15-/m0/s1 |
| InChIKey | PPRYTBFVNQXABW-HNNXBMFYSA-N |
| XLogP | 2.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |