C17H16O2 — CID 125487184
5-[(4-hydroxyphenyl)methyl]-7,8-dihydronaphthalen-2-ol (PubChem CID 125487184) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 5-[(4-hydroxyphenyl)methyl]-7,8-dihydronaphthalen-2-ol.
| Compound Name | 5-[(4-hydroxyphenyl)methyl]-7,8-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 125487184 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 5-[(4-hydroxyphenyl)methyl]-7,8-dihydronaphthalen-2-ol |
| SMILES | Oc1ccc(CC2=CCCc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C17H16O2/c18-15-6-4-12(5-7-15)10-13-2-1-3-14-11-16(19)8-9-17(13)14/h2,4-9,11,18-19H,1,3,10H2 |
| InChIKey | WBYQWSIAVZCOFL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |