C13H15ClO — CID 42644023
5-(3-chloropropyl)-7,8-dihydronaphthalen-2-ol (PubChem CID 42644023) has the molecular formula C13H15ClO and a molecular weight of 222.71 g/mol. Its IUPAC name is 5-(3-chloropropyl)-7,8-dihydronaphthalen-2-ol.
| Compound Name | 5-(3-chloropropyl)-7,8-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 42644023 |
| Molecular Formula | C13H15ClO |
| Molecular Weight | 222.71 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 5-(3-chloropropyl)-7,8-dihydronaphthalen-2-ol |
| SMILES | Oc1ccc2c(c1)CCC=C2CCCCl |
| InChI | InChI=1S/C13H15ClO/c14-8-2-5-10-3-1-4-11-9-12(15)6-7-13(10)11/h3,6-7,9,15H,1-2,4-5,8H2 |
| InChIKey | DWAKXDZDMAFXIF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.71 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|