C7H15N2O2PS — CID 12548981
2-ethoxy-1,3-dimethyl-2-sulfanylidene-1,3,2lambda5-diazaphosphinan-4-one (PubChem CID 12548981) has the molecular formula C7H15N2O2PS and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-ethoxy-1,3-dimethyl-2-sulfanylidene-1,3,2lambda5-diazaphosphinan-4-one.
| Compound Name | 2-ethoxy-1,3-dimethyl-2-sulfanylidene-1,3,2lambda5-diazaphosphinan-4-one |
|---|---|
| PubChem CID | 12548981 |
| Molecular Formula | C7H15N2O2PS |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-ethoxy-1,3-dimethyl-2-sulfanylidene-1,3,2lambda5-diazaphosphinan-4-one |
| SMILES | CCOP1(=S)N(C)CCC(=O)N1C |
| InChI | InChI=1S/C7H15N2O2PS/c1-4-11-12(13)8(2)6-5-7(10)9(12)3/h4-6H2,1-3H3 |
| InChIKey | AUMKEPGZHINLBQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|