C9H10F3NO3S — CID 125496552
1,1,1-trifluoro-N-(4-hydroxy-2,6-dimethylphenyl)methanesulfonamide (PubChem CID 125496552) has the molecular formula C9H10F3NO3S and a molecular weight of 269.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(4-hydroxy-2,6-dimethylphenyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(4-hydroxy-2,6-dimethylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 125496552 |
| Molecular Formula | C9H10F3NO3S |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 1,1,1-trifluoro-N-(4-hydroxy-2,6-dimethylphenyl)methanesulfonamide |
| SMILES | Cc1cc(O)cc(C)c1NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO3S/c1-5-3-7(14)4-6(2)8(5)13-17(15,16)9(10,11)12/h3-4,13-14H,1-2H3 |
| InChIKey | CNRDNNLURHMPIL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|