C18H21BrN2O5S — CID 1256669
(2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide (PubChem CID 1256669) has the molecular formula C18H21BrN2O5S and a molecular weight of 457.35 g/mol. Its IUPAC name is (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide.
| Compound Name | (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 1256669 |
| Molecular Formula | C18H21BrN2O5S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)NC1CCCC1)N1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C18H21BrN2O5S/c1-27(25,26)9-8-15(16(22)20-12-4-2-3-5-12)21-17(23)13-7-6-11(19)10-14(13)18(21)24/h6-7,10,12,15H,2-5,8-9H2,1H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | CVUDLSJNJDSMLV-OAHLLOKOSA-N |
| XLogP | 1.91 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|