About (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide
(2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide (PubChem CID 1256669) has the molecular formula C18H21BrN2O5S
and a molecular weight of 457.35 g/mol. Its IUPAC name is (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide.
Molecular Properties
| Compound Name | (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide |
| PubChem CID | 1256669 |
| Molecular Formula | C18H21BrN2O5S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)NC1CCCC1)N1C(=O)c2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C18H21BrN2O5S/c1-27(25,26)9-8-15(16(22)20-12-4-2-3-5-12)21-17(23)13-7-6-11(19)10-14(13)18(21)24/h6-7,10,12,15H,2-5,8-9H2,1H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | CVUDLSJNJDSMLV-OAHLLOKOSA-N |
| XLogP | 1.91 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide?
The IUPAC name of (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide (CID 1256669) is (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide.
What is the SMILES notation for (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide?
The canonical SMILES for (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide is CS(=O)(=O)CC[C@H](C(=O)NC1CCCC1)N1C(=O)c2ccc(Br)cc2C1=O.
What is the InChIKey of (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide?
The InChIKey is CVUDLSJNJDSMLV-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H21BrN2O5S/c1-27(25,26)9-8-15(16(22)20-12-4-2-3-5-12)21-17(23)13-7-6-11(19)10-14(13)18(21)24/h6-7,10,12,15H,2-5,8-9H2,1H3,(H,20,22)/t15-/m1/s1.
What are the key properties of (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide?
(2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide has a molecular weight of 457.35 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(5-bromo-1,3-dioxoisoindol-2-yl)-N-cyclopentyl-4-methylsulfonylbutanamide is sourced from PubChem (CID 1256669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).