C6H11NO — CID 12580560
2,6-dimethyl-3,6-dihydrooxazine (PubChem CID 12580560) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is 2,6-dimethyl-3,6-dihydrooxazine.
| Compound Name | 2,6-dimethyl-3,6-dihydrooxazine |
|---|---|
| PubChem CID | 12580560 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2,6-dimethyl-3,6-dihydrooxazine |
| SMILES | CC1C=CCN(C)O1 |
| InChI | InChI=1S/C6H11NO/c1-6-4-3-5-7(2)8-6/h3-4,6H,5H2,1-2H3 |
| InChIKey | DJJGTCHCNQPCAH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|