C10H21N3 — CID 18730083
2-N,2-N,3-N,3-N,1-pentamethyl-3,6-dihydro-2H-pyridine-2,3-diamine (PubChem CID 18730083) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is 2-N,2-N,3-N,3-N,1-pentamethyl-3,6-dihydro-2H-pyridine-2,3-diamine.
| Compound Name | 2-N,2-N,3-N,3-N,1-pentamethyl-3,6-dihydro-2H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 18730083 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 2-N,2-N,3-N,3-N,1-pentamethyl-3,6-dihydro-2H-pyridine-2,3-diamine |
| SMILES | CN(C)C1C=CCN(C)C1N(C)C |
| InChI | InChI=1S/C10H21N3/c1-11(2)9-7-6-8-13(5)10(9)12(3)4/h6-7,9-10H,8H2,1-5H3 |
| InChIKey | ZPIGEYFZNLJJDD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|