C6H11NS — CID 70559224
2,3-dimethyl-2,4-dihydro-1,3-thiazine (PubChem CID 70559224) has the molecular formula C6H11NS and a molecular weight of 129.23 g/mol. Its IUPAC name is 2,3-dimethyl-2,4-dihydro-1,3-thiazine.
| Compound Name | 2,3-dimethyl-2,4-dihydro-1,3-thiazine |
|---|---|
| PubChem CID | 70559224 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | 2,3-dimethyl-2,4-dihydro-1,3-thiazine |
| SMILES | CC1SC=CCN1C |
| InChI | InChI=1S/C6H11NS/c1-6-7(2)4-3-5-8-6/h3,5-6H,4H2,1-2H3 |
| InChIKey | YOWAOEVPWCJTGT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |