C8H15N — CID 153356137
1-methyl-2-propyl-2,5-dihydropyrrole (PubChem CID 153356137) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is 1-methyl-2-propyl-2,5-dihydropyrrole.
| Compound Name | 1-methyl-2-propyl-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 153356137 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 1-methyl-2-propyl-2,5-dihydropyrrole |
| SMILES | CCCC1C=CCN1C |
| InChI | InChI=1S/C8H15N/c1-3-5-8-6-4-7-9(8)2/h4,6,8H,3,5,7H2,1-2H3 |
| InChIKey | HGXMPVDMUPERHT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|