C10H16N2 — CID 12581459
5-ethyl-1,2-dimethyl-3,6-dihydro-2H-pyridine-6-carbonitrile (PubChem CID 12581459) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-ethyl-1,2-dimethyl-3,6-dihydro-2H-pyridine-6-carbonitrile.
| Compound Name | 5-ethyl-1,2-dimethyl-3,6-dihydro-2H-pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 12581459 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 5-ethyl-1,2-dimethyl-3,6-dihydro-2H-pyridine-6-carbonitrile |
| SMILES | CCC1=CCC(C)N(C)C1C#N |
| InChI | InChI=1S/C10H16N2/c1-4-9-6-5-8(2)12(3)10(9)7-11/h6,8,10H,4-5H2,1-3H3 |
| InChIKey | CNSYHKJGHWADCR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|