C12H19NO2 — CID 12581843
(4aR,7aS)-spiro[3,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazine-2,1'-cyclohexane]-4-one (PubChem CID 12581843) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (4aR,7aS)-spiro[3,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazine-2,1'-cyclohexane]-4-one.
| Compound Name | (4aR,7aS)-spiro[3,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazine-2,1'-cyclohexane]-4-one |
|---|---|
| PubChem CID | 12581843 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (4aR,7aS)-spiro[3,4a,5,6,7,7a-hexahydrocyclopenta[e][1,3]oxazine-2,1'-cyclohexane]-4-one |
| SMILES | O=C1NC2(CCCCC2)O[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C12H19NO2/c14-11-9-5-4-6-10(9)15-12(13-11)7-2-1-3-8-12/h9-10H,1-8H2,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | XBMDLIXWSMHTBW-ZJUUUORDSA-N |
| XLogP | 1.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |