C19H14 — CID 12596
5-Methylbenzo(c)phenanthrene (PubChem CID 12596) has the molecular formula C19H14 and a molecular weight of 242.30 g/mol. Its IUPAC name is 5-methylbenzo[c]phenanthrene.
| Compound Name | 5-Methylbenzo(c)phenanthrene |
|---|---|
| PubChem CID | 12596 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 5-methylbenzo[c]phenanthrene |
| SMILES | CC1=CC2=C(C3=CC=CC=C3C=C2)C4=CC=CC=C14 |
| InChIKey | PSEUAMGCKSRKQL-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 0 |
| H-Bond Acceptors | 0 |
| Rotatable Bonds | 0 |
| Heavy Atoms | 19 |
| Complexity | 320 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|