C14H17ClO5 — CID 12600053
2-chloro-3,3,4,4-tetramethoxy-2-phenylcyclobutan-1-one (PubChem CID 12600053) has the molecular formula C14H17ClO5 and a molecular weight of 300.74 g/mol. Its IUPAC name is 2-chloro-3,3,4,4-tetramethoxy-2-phenylcyclobutan-1-one.
| Compound Name | 2-chloro-3,3,4,4-tetramethoxy-2-phenylcyclobutan-1-one |
|---|---|
| PubChem CID | 12600053 |
| Molecular Formula | C14H17ClO5 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-chloro-3,3,4,4-tetramethoxy-2-phenylcyclobutan-1-one |
| SMILES | COC1(OC)C(=O)C(Cl)(c2ccccc2)C1(OC)OC |
| InChI | InChI=1S/C14H17ClO5/c1-17-13(18-2)11(16)12(15,14(13,19-3)20-4)10-8-6-5-7-9-10/h5-9H,1-4H3 |
| InChIKey | WWLSWHLHTVCECS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|