C26H17Cl2N3O2 — CID 126046154
N-[(Z)-(3,5-dichloro-2-prop-2-ynoxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126046154) has the molecular formula C26H17Cl2N3O2 and a molecular weight of 474.35 g/mol. Its IUPAC name is N-[(Z)-(3,5-dichloro-2-prop-2-ynoxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-(3,5-dichloro-2-prop-2-ynoxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126046154 |
| Molecular Formula | C26H17Cl2N3O2 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | N-[(Z)-(3,5-dichloro-2-prop-2-ynoxyphenyl)methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | C#CCOc1c(Cl)cc(Cl)cc1/C=N\NC(=O)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C26H17Cl2N3O2/c1-2-12-33-25-18(13-19(27)14-22(25)28)16-29-31-26(32)21-15-24(17-8-4-3-5-9-17)30-23-11-7-6-10-20(21)23/h1,3-11,13-16H,12H2,(H,31,32)/b29-16- |
| InChIKey | RXXCYWQWMHMDSQ-MWLSYYOVSA-N |
| XLogP | 5.98 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|