C22H14Br2FNO — CID 126053623
(Z)-3-[3,5-dibromo-2-[(3-fluorophenyl)methoxy]phenyl]-2-phenylprop-2-enenitrile (PubChem CID 126053623) has the molecular formula C22H14Br2FNO and a molecular weight of 487.17 g/mol. Its IUPAC name is (Z)-3-[3,5-dibromo-2-[(3-fluorophenyl)methoxy]phenyl]-2-phenylprop-2-enenitrile.
| Compound Name | (Z)-3-[3,5-dibromo-2-[(3-fluorophenyl)methoxy]phenyl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 126053623 |
| Molecular Formula | C22H14Br2FNO |
| Molecular Weight | 487.17 g/mol |
| Exact Mass | 484.94 |
| IUPAC Name | (Z)-3-[3,5-dibromo-2-[(3-fluorophenyl)methoxy]phenyl]-2-phenylprop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(Br)cc(Br)c1OCc1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C22H14Br2FNO/c23-19-11-17(10-18(13-26)16-6-2-1-3-7-16)22(21(24)12-19)27-14-15-5-4-8-20(25)9-15/h1-12H,14H2/b18-10+ |
| InChIKey | NSEONDZTLYBRSW-VCHYOVAHSA-N |
| XLogP | 6.99 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.17 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|