C26H20BrClN4O6S — CID 126069245
2-[4-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide (PubChem CID 126069245) has the molecular formula C26H20BrClN4O6S and a molecular weight of 631.89 g/mol. Its IUPAC name is 2-[4-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[4-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126069245 |
| Molecular Formula | C26H20BrClN4O6S |
| Molecular Weight | 631.89 g/mol |
| Exact Mass | 630.00 |
| IUPAC Name | 2-[4-[(E)-[2-(4-bromo-3-chlorophenyl)imino-3-methyl-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-N-(3-nitrophenyl)acetamide |
| SMILES | COc1cc(/C=C2/S/C(=N\c3ccc(Br)c(Cl)c3)N(C)C2=O)ccc1OCC(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H20BrClN4O6S/c1-31-25(34)23(39-26(31)30-17-7-8-19(27)20(28)13-17)11-15-6-9-21(22(10-15)37-2)38-14-24(33)29-16-4-3-5-18(12-16)32(35)36/h3-13H,14H2,1-2H3,(H,29,33)/b23-11+,30-26- |
| InChIKey | CBIXAEFAMQTDRQ-JLDHHGAISA-N |
| XLogP | 6.27 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|