C17H10ClFN6O — CID 126069827
(E)-1-[2-(2-chloro-5-fluoropyrimidin-4-yl)oxynaphthalen-1-yl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 126069827) has the molecular formula C17H10ClFN6O and a molecular weight of 368.76 g/mol. Its IUPAC name is (E)-1-[2-(2-chloro-5-fluoropyrimidin-4-yl)oxynaphthalen-1-yl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-[2-(2-chloro-5-fluoropyrimidin-4-yl)oxynaphthalen-1-yl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 126069827 |
| Molecular Formula | C17H10ClFN6O |
| Molecular Weight | 368.76 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (E)-1-[2-(2-chloro-5-fluoropyrimidin-4-yl)oxynaphthalen-1-yl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Fc1cnc(Cl)nc1Oc1ccc2ccccc2c1/C=N/n1cnnc1 |
| InChI | InChI=1S/C17H10ClFN6O/c18-17-20-8-14(19)16(24-17)26-15-6-5-11-3-1-2-4-12(11)13(15)7-23-25-9-21-22-10-25/h1-10H/b23-7+ |
| InChIKey | KVPJMGNYPIILRA-HCGXMYGOSA-N |
| XLogP | 3.69 |
| TPSA | 78.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|