C27H17F3IN3O9 — CID 126094938
methyl 4-[(5E)-5-[[3-iodo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 126094938) has the molecular formula C27H17F3IN3O9 and a molecular weight of 711.34 g/mol. Its IUPAC name is methyl 4-[(5E)-5-[[3-iodo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[(5E)-5-[[3-iodo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 126094938 |
| Molecular Formula | C27H17F3IN3O9 |
| Molecular Weight | 711.34 g/mol |
| Exact Mass | 711.00 |
| IUPAC Name | methyl 4-[(5E)-5-[[3-iodo-5-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)/C(=C\c3cc(I)c(Oc4ccc(C(F)(F)F)cc4[N+](=O)[O-])c(OC)c3)C2=O)cc1 |
| InChI | InChI=1S/C27H17F3IN3O9/c1-41-21-11-13(10-18(31)22(21)43-20-8-5-15(27(28,29)30)12-19(20)34(39)40)9-17-23(35)32-26(38)33(24(17)36)16-6-3-14(4-7-16)25(37)42-2/h3-12H,1-2H3,(H,32,35,38)/b17-9+ |
| InChIKey | FPUVSLHAWQWZSR-RQZCQDPDSA-N |
| XLogP | 5.47 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|