C31H23ClF3NO2 — CID 126096253
(1S,2R,6R,7S)-10-[bis(4-methylphenyl)methylidene]-4-[2-chloro-5-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126096253) has the molecular formula C31H23ClF3NO2 and a molecular weight of 533.98 g/mol. Its IUPAC name is (1S,2R,6R,7S)-10-[bis(4-methylphenyl)methylidene]-4-[2-chloro-5-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S)-10-[bis(4-methylphenyl)methylidene]-4-[2-chloro-5-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126096253 |
| Molecular Formula | C31H23ClF3NO2 |
| Molecular Weight | 533.98 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | (1S,2R,6R,7S)-10-[bis(4-methylphenyl)methylidene]-4-[2-chloro-5-(trifluoromethyl)phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | Cc1ccc(C(=C2[C@H]3C=C[C@H]2[C@H]2C(=O)N(c4cc(C(F)(F)F)ccc4Cl)C(=O)[C@@H]23)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H23ClF3NO2/c1-16-3-7-18(8-4-16)25(19-9-5-17(2)6-10-19)26-21-12-13-22(26)28-27(21)29(37)36(30(28)38)24-15-20(31(33,34)35)11-14-23(24)32/h3-15,21-22,27-28H,1-2H3/t21-,22-,27-,28-/m1/s1 |
| InChIKey | KYRMEVZJXIFVAK-TUJIQRHUSA-N |
| XLogP | 7.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.98 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|