C17H19NO3S2 — CID 12614365
4-methyl-N-[(E)-3-phenylbut-2-enyl]sulfinylbenzenesulfonamide (PubChem CID 12614365) has the molecular formula C17H19NO3S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-methyl-N-[(E)-3-phenylbut-2-enyl]sulfinylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[(E)-3-phenylbut-2-enyl]sulfinylbenzenesulfonamide |
|---|---|
| PubChem CID | 12614365 |
| Molecular Formula | C17H19NO3S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-methyl-N-[(E)-3-phenylbut-2-enyl]sulfinylbenzenesulfonamide |
| SMILES | C/C(=C\CS(=O)NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3S2/c1-14-8-10-17(11-9-14)23(20,21)18-22(19)13-12-15(2)16-6-4-3-5-7-16/h3-12,18H,13H2,1-2H3/b15-12+ |
| InChIKey | XIIKPNFGKFJKRZ-NTCAYCPXSA-N |
| XLogP | 3.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |