C12H7ClINO5S — CID 126151062
2-[(5E)-5-[(5-chloro-2-hydroxy-3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126151062) has the molecular formula C12H7ClINO5S and a molecular weight of 439.61 g/mol. Its IUPAC name is 2-[(5E)-5-[(5-chloro-2-hydroxy-3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(5-chloro-2-hydroxy-3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126151062 |
| Molecular Formula | C12H7ClINO5S |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 438.88 |
| IUPAC Name | 2-[(5E)-5-[(5-chloro-2-hydroxy-3-iodophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C/c2cc(Cl)cc(I)c2O)C1=O |
| InChI | InChI=1S/C12H7ClINO5S/c13-6-1-5(10(18)7(14)3-6)2-8-11(19)15(4-9(16)17)12(20)21-8/h1-3,18H,4H2,(H,16,17)/b8-2+ |
| InChIKey | PWMVTCNRYCCKNK-KRXBUXKQSA-N |
| XLogP | 2.77 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|