C29H27N3O3S3 — CID 126151186
2-[7-ethyl-3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 126151186) has the molecular formula C29H27N3O3S3 and a molecular weight of 561.75 g/mol. Its IUPAC name is 2-[7-ethyl-3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[7-ethyl-3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 126151186 |
| Molecular Formula | C29H27N3O3S3 |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | 2-[7-ethyl-3-[(Z)-[3-[(4-methoxyphenyl)methyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]indol-1-yl]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCc1cccc2c(/C=C3\SC(=S)N(Cc4ccc(OC)cc4)C3=O)cn(CC(=O)NCc3cccs3)c12 |
| InChI | InChI=1S/C29H27N3O3S3/c1-3-20-6-4-8-24-21(17-31(27(20)24)18-26(33)30-15-23-7-5-13-37-23)14-25-28(34)32(29(36)38-25)16-19-9-11-22(35-2)12-10-19/h4-14,17H,3,15-16,18H2,1-2H3,(H,30,33)/b25-14- |
| InChIKey | HBYSVNYPCADUIM-QFEZKATASA-N |
| XLogP | 5.99 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|