C25H23ClN2O3S2 — CID 126151568
(5S)-5-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126151568) has the molecular formula C25H23ClN2O3S2 and a molecular weight of 499.06 g/mol. Its IUPAC name is (5S)-5-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5S)-5-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126151568 |
| Molecular Formula | C25H23ClN2O3S2 |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | (5S)-5-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-3-(pyridin-3-ylmethyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(C[C@@H]2SC(=S)N(Cc3cccnc3)C2=O)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C25H23ClN2O3S2/c1-2-30-22-12-17(8-9-21(22)31-16-18-5-3-7-20(26)11-18)13-23-24(29)28(25(32)33-23)15-19-6-4-10-27-14-19/h3-12,14,23H,2,13,15-16H2,1H3/t23-/m0/s1 |
| InChIKey | NUBUQLPRBNLBQA-QHCPKHFHSA-N |
| XLogP | 5.68 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|