C24H16N2O5S — CID 126154008
2-[(5E)-5-[[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 126154008) has the molecular formula C24H16N2O5S and a molecular weight of 444.47 g/mol. Its IUPAC name is 2-[(5E)-5-[[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 126154008 |
| Molecular Formula | C24H16N2O5S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2-[(5E)-5-[[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | N#Cc1ccccc1COc1ccc2ccccc2c1/C=C1/SC(=O)N(CC(=O)O)C1=O |
| InChI | InChI=1S/C24H16N2O5S/c25-12-16-6-1-2-7-17(16)14-31-20-10-9-15-5-3-4-8-18(15)19(20)11-21-23(29)26(13-22(27)28)24(30)32-21/h1-11H,13-14H2,(H,27,28)/b21-11+ |
| InChIKey | VQNKCUANCZCION-SRZZPIQSSA-N |
| XLogP | 4.41 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|