C31H25NO5S — CID 126138539
4-[[1-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid (PubChem CID 126138539) has the molecular formula C31H25NO5S and a molecular weight of 523.61 g/mol. Its IUPAC name is 4-[[1-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid.
| Compound Name | 4-[[1-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 126138539 |
| Molecular Formula | C31H25NO5S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 4-[[1-[(E)-[2,4-dioxo-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]naphthalen-2-yl]oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc3ccccc3c2/C=C2/SC(=O)N(CCCc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C31H25NO5S/c33-29-28(38-31(36)32(29)18-6-9-21-7-2-1-3-8-21)19-26-25-11-5-4-10-23(25)16-17-27(26)37-20-22-12-14-24(15-13-22)30(34)35/h1-5,7-8,10-17,19H,6,9,18,20H2,(H,34,35)/b28-19+ |
| InChIKey | NOJNDDWRBQEGHB-TURZUDJPSA-N |
| XLogP | 6.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|