C42H27N3O3 — CID 126155814
2-[[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile (PubChem CID 126155814) has the molecular formula C42H27N3O3 and a molecular weight of 621.70 g/mol. Its IUPAC name is 2-[[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile.
| Compound Name | 2-[[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 126155814 |
| Molecular Formula | C42H27N3O3 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | 2-[[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-4,5-diphenylfuran-3-carbonitrile |
| SMILES | N#Cc1c(N=CC23c4ccccc4C(c4ccccc42)[C@H]2C(=O)N(c4ccccc4)C(=O)[C@@H]23)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C42H27N3O3/c43-24-31-34(26-14-4-1-5-15-26)38(27-16-6-2-7-17-27)48-39(31)44-25-42-32-22-12-10-20-29(32)35(30-21-11-13-23-33(30)42)36-37(42)41(47)45(40(36)46)28-18-8-3-9-19-28/h1-23,25,35-37H/t35?,36-,37-,42?/m1/s1 |
| InChIKey | JDPKRZXIBUKCQK-QOIODDNWSA-N |
| XLogP | 8.44 |
| TPSA | 86.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|