C43H37FN4O3S — CID 126191258
N-benzhydryl-2-[(5E)-5-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide (PubChem CID 126191258) has the molecular formula C43H37FN4O3S and a molecular weight of 708.86 g/mol. Its IUPAC name is N-benzhydryl-2-[(5E)-5-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzhydryl-2-[(5E)-5-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 126191258 |
| Molecular Formula | C43H37FN4O3S |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.26 |
| IUPAC Name | N-benzhydryl-2-[(5E)-5-[[1-[(2-fluorophenyl)methyl]-2-methylindol-3-yl]methylidene]-1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-4,6-dioxopyrimidin-2-yl]sulfanylacetamide |
| SMILES | C=C/C=C\C(=C/C)N1C(=O)/C(=C/c2c(C)n(Cc3ccccc3F)c3ccccc23)C(=O)N=C1SCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H37FN4O3S/c1-4-6-22-33(5-2)48-42(51)36(26-35-29(3)47(38-25-16-14-23-34(35)38)27-32-21-13-15-24-37(32)44)41(50)46-43(48)52-28-39(49)45-40(30-17-9-7-10-18-30)31-19-11-8-12-20-31/h4-26,40H,1,27-28H2,2-3H3,(H,45,49)/b22-6-,33-5+,36-26+ |
| InChIKey | ZXTNJTJHTHDPLA-FIACUALZSA-N |
| XLogP | 8.53 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|