C20H13Br2ClFNO — CID 126191305
N-(3-chloro-4-fluorophenyl)-1-[4-[(2,4-dibromophenyl)methoxy]phenyl]methanimine (PubChem CID 126191305) has the molecular formula C20H13Br2ClFNO and a molecular weight of 497.59 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1-[4-[(2,4-dibromophenyl)methoxy]phenyl]methanimine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1-[4-[(2,4-dibromophenyl)methoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 126191305 |
| Molecular Formula | C20H13Br2ClFNO |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 494.90 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1-[4-[(2,4-dibromophenyl)methoxy]phenyl]methanimine |
| SMILES | Fc1ccc(/N=C/c2ccc(OCc3ccc(Br)cc3Br)cc2)cc1Cl |
| InChI | InChI=1S/C20H13Br2ClFNO/c21-15-4-3-14(18(22)9-15)12-26-17-6-1-13(2-7-17)11-25-16-5-8-20(24)19(23)10-16/h1-11H,12H2/b25-11+ |
| InChIKey | QPOFOGBAQGBIFS-OPEKNORGSA-N |
| XLogP | 7.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|