C20H14Br2INO — CID 126191637
1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-(4-iodophenyl)methanimine (PubChem CID 126191637) has the molecular formula C20H14Br2INO and a molecular weight of 571.05 g/mol. Its IUPAC name is 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-(4-iodophenyl)methanimine.
| Compound Name | 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-(4-iodophenyl)methanimine |
|---|---|
| PubChem CID | 126191637 |
| Molecular Formula | C20H14Br2INO |
| Molecular Weight | 571.05 g/mol |
| Exact Mass | 568.85 |
| IUPAC Name | 1-[4-[(2,4-dibromophenyl)methoxy]phenyl]-N-(4-iodophenyl)methanimine |
| SMILES | Brc1ccc(COc2ccc(/C=N/c3ccc(I)cc3)cc2)c(Br)c1 |
| InChI | InChI=1S/C20H14Br2INO/c21-16-4-3-15(20(22)11-16)13-25-19-9-1-14(2-10-19)12-24-18-7-5-17(23)6-8-18/h1-12H,13H2/b24-12+ |
| InChIKey | YCPVSOVNXZKEIZ-WYMPLXKRSA-N |
| XLogP | 7.15 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.05 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|