C21H14Br2ClNO3 — CID 126193203
2-chloro-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]benzoic acid (PubChem CID 126193203) has the molecular formula C21H14Br2ClNO3 and a molecular weight of 523.61 g/mol. Its IUPAC name is 2-chloro-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]benzoic acid.
| Compound Name | 2-chloro-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 126193203 |
| Molecular Formula | C21H14Br2ClNO3 |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 520.90 |
| IUPAC Name | 2-chloro-5-[[4-[(2,4-dibromophenyl)methoxy]phenyl]methylideneamino]benzoic acid |
| SMILES | O=C(O)c1cc(/N=C/c2ccc(OCc3ccc(Br)cc3Br)cc2)ccc1Cl |
| InChI | InChI=1S/C21H14Br2ClNO3/c22-15-4-3-14(19(23)9-15)12-28-17-6-1-13(2-7-17)11-25-16-5-8-20(24)18(10-16)21(26)27/h1-11H,12H2,(H,26,27)/b25-11+ |
| InChIKey | KDBKYVXEWIVKCP-OPEKNORGSA-N |
| XLogP | 6.89 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|