C24H23BrFN3O5S — CID 126192035
N-[(Z)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(2-fluoro-N-methylsulfonylanilino)acetamide (PubChem CID 126192035) has the molecular formula C24H23BrFN3O5S and a molecular weight of 564.43 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(2-fluoro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(2-fluoro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126192035 |
| Molecular Formula | C24H23BrFN3O5S |
| Molecular Weight | 564.43 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | N-[(Z)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(2-fluoro-N-methylsulfonylanilino)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CN(c2ccccc2F)S(C)(=O)=O)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H23BrFN3O5S/c1-33-22-13-18(12-19(25)24(22)34-16-17-8-4-3-5-9-17)14-27-28-23(30)15-29(35(2,31)32)21-11-7-6-10-20(21)26/h3-14H,15-16H2,1-2H3,(H,28,30)/b27-14- |
| InChIKey | QAQXBNKMKKEHEF-VYYCAZPPSA-N |
| XLogP | 4.09 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|