C21H23BrClN3O5S — CID 124534838
N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-(3-chloro-2-methyl-N-methylsulfonylanilino)acetamide (PubChem CID 124534838) has the molecular formula C21H23BrClN3O5S and a molecular weight of 544.86 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-(3-chloro-2-methyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-(3-chloro-2-methyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 124534838 |
| Molecular Formula | C21H23BrClN3O5S |
| Molecular Weight | 544.86 g/mol |
| Exact Mass | 543.02 |
| IUPAC Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-2-(3-chloro-2-methyl-N-methylsulfonylanilino)acetamide |
| SMILES | C=CCOc1c(Br)cc(/C=N\NC(=O)CN(c2cccc(Cl)c2C)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C21H23BrClN3O5S/c1-5-9-31-21-16(22)10-15(11-19(21)30-3)12-24-25-20(27)13-26(32(4,28)29)18-8-6-7-17(23)14(18)2/h5-8,10-12H,1,9,13H2,2-4H3,(H,25,27)/b24-12- |
| InChIKey | VVEKEHCCSKEMHH-MSXFZWOLSA-N |
| XLogP | 3.90 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|