C24H20Cl2N2O3S — CID 126210855
(E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide (PubChem CID 126210855) has the molecular formula C24H20Cl2N2O3S and a molecular weight of 487.41 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 126210855 |
| Molecular Formula | C24H20Cl2N2O3S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | (E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-N-(thiophen-2-ylmethyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)NCc2cccs2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H20Cl2N2O3S/c1-2-30-23-11-16(10-18(13-27)24(29)28-14-20-4-3-9-32-20)5-8-22(23)31-15-17-6-7-19(25)12-21(17)26/h3-12H,2,14-15H2,1H3,(H,28,29)/b18-10+ |
| InChIKey | CDNLXYWRDBQKSZ-VCHYOVAHSA-N |
| XLogP | 6.26 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|