C26H19F3N2O3 — CID 126214973
N-(2,4-dimethylphenyl)-1-[2-[2-nitro-4-(trifluoromethyl)phenoxy]naphthalen-1-yl]methanimine (PubChem CID 126214973) has the molecular formula C26H19F3N2O3 and a molecular weight of 464.44 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-[2-[2-nitro-4-(trifluoromethyl)phenoxy]naphthalen-1-yl]methanimine.
| Compound Name | N-(2,4-dimethylphenyl)-1-[2-[2-nitro-4-(trifluoromethyl)phenoxy]naphthalen-1-yl]methanimine |
|---|---|
| PubChem CID | 126214973 |
| Molecular Formula | C26H19F3N2O3 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-[2-[2-nitro-4-(trifluoromethyl)phenoxy]naphthalen-1-yl]methanimine |
| SMILES | Cc1ccc(/N=C/c2c(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])ccc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C26H19F3N2O3/c1-16-7-10-22(17(2)13-16)30-15-21-20-6-4-3-5-18(20)8-11-24(21)34-25-12-9-19(26(27,28)29)14-23(25)31(32)33/h3-15H,1-2H3/b30-15+ |
| InChIKey | DERMNOYWJXMISD-FJEPWZHXSA-N |
| XLogP | 7.93 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|