C43H45N5O3S — CID 126297112
2-[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126297112) has the molecular formula C43H45N5O3S and a molecular weight of 711.93 g/mol. Its IUPAC name is 2-[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126297112 |
| Molecular Formula | C43H45N5O3S |
| Molecular Weight | 711.93 g/mol |
| Exact Mass | 711.32 |
| IUPAC Name | 2-[3-[[2-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCOc1cc(C)c(-c2nc3ccccc3c(=O)n2N=Cc2cc(C)n(-c3sc4c(c3C(=O)Nc3ccc(C)cc3)CCCC4)c2C)cc1C(C)C |
| InChI | InChI=1S/C43H45N5O3S/c1-8-51-37-21-27(5)35(23-34(37)25(2)3)40-46-36-15-11-9-13-32(36)42(50)48(40)44-24-30-22-28(6)47(29(30)7)43-39(33-14-10-12-16-38(33)52-43)41(49)45-31-19-17-26(4)18-20-31/h9,11,13,15,17-25H,8,10,12,14,16H2,1-7H3,(H,45,49) |
| InChIKey | BENJFRMVKMIAAQ-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.93 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|