C26H18N2O6S — CID 126315882
[4-[(Z)-2-cyano-2-naphthalen-1-ylethenyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate (PubChem CID 126315882) has the molecular formula C26H18N2O6S and a molecular weight of 486.51 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-2-naphthalen-1-ylethenyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-2-cyano-2-naphthalen-1-ylethenyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 126315882 |
| Molecular Formula | C26H18N2O6S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | [4-[(Z)-2-cyano-2-naphthalen-1-ylethenyl]-2-methoxyphenyl] 2-nitrobenzenesulfonate |
| SMILES | COc1cc(/C=C(\C#N)c2cccc3ccccc23)ccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H18N2O6S/c1-33-25-16-18(15-20(17-27)22-10-6-8-19-7-2-3-9-21(19)22)13-14-24(25)34-35(31,32)26-12-5-4-11-23(26)28(29)30/h2-16H,1H3/b20-15+ |
| InChIKey | LTVKHZMAPFRNAK-HMMYKYKNSA-N |
| XLogP | 5.59 |
| TPSA | 119.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|