C27H20N4O7S2 — CID 170912696
[4-[(Z)-2-cyano-3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-1-enyl]-2-ethoxyphenyl] 2-nitrobenzenesulfonate (PubChem CID 170912696) has the molecular formula C27H20N4O7S2 and a molecular weight of 576.61 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-1-enyl]-2-ethoxyphenyl] 2-nitrobenzenesulfonate.
| Compound Name | [4-[(Z)-2-cyano-3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-1-enyl]-2-ethoxyphenyl] 2-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 170912696 |
| Molecular Formula | C27H20N4O7S2 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.08 |
| IUPAC Name | [4-[(Z)-2-cyano-3-oxo-3-[(4-phenyl-1,3-thiazol-2-yl)amino]prop-1-enyl]-2-ethoxyphenyl] 2-nitrobenzenesulfonate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2nc(-c3ccccc3)cs2)ccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H20N4O7S2/c1-2-37-24-15-18(12-13-23(24)38-40(35,36)25-11-7-6-10-22(25)31(33)34)14-20(16-28)26(32)30-27-29-21(17-39-27)19-8-4-3-5-9-19/h3-15,17H,2H2,1H3,(H,29,30,32)/b20-14- |
| InChIKey | MQLNQROJUQZCBP-ZHZULCJRSA-N |
| XLogP | 5.43 |
| TPSA | 161.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|