C28H26BrN5O2 — CID 126317679
2-[[2-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]methyl]benzonitrile (PubChem CID 126317679) has the molecular formula C28H26BrN5O2 and a molecular weight of 544.45 g/mol. Its IUPAC name is 2-[[2-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126317679 |
| Molecular Formula | C28H26BrN5O2 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 2-[[2-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-5-(dimethylamino)phenoxy]methyl]benzonitrile |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(N(C)C)cc1OCc1ccccc1C#N |
| InChI | InChI=1S/C28H26BrN5O2/c1-4-7-27-32-25-13-11-22(29)14-24(25)28(35)34(27)31-17-20-10-12-23(33(2)3)15-26(20)36-18-21-9-6-5-8-19(21)16-30/h5-6,8-15,17H,4,7,18H2,1-3H3 |
| InChIKey | AFFYTYBHCTWWPN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 83.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|