C24H21Br2N3O6 — CID 126329596
N-[(E)-[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-methoxybenzamide (PubChem CID 126329596) has the molecular formula C24H21Br2N3O6 and a molecular weight of 607.26 g/mol. Its IUPAC name is N-[(E)-[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-methoxybenzamide.
| Compound Name | N-[(E)-[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 126329596 |
| Molecular Formula | C24H21Br2N3O6 |
| Molecular Weight | 607.26 g/mol |
| Exact Mass | 604.98 |
| IUPAC Name | N-[(E)-[3,5-dibromo-2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-3-ethoxy-4-methoxybenzamide |
| SMILES | CCOc1cc(C(=O)N/N=C/c2cc(Br)cc(Br)c2OCc2ccc([N+](=O)[O-])cc2)ccc1OC |
| InChI | InChI=1S/C24H21Br2N3O6/c1-3-34-22-11-16(6-9-21(22)33-2)24(30)28-27-13-17-10-18(25)12-20(26)23(17)35-14-15-4-7-19(8-5-15)29(31)32/h4-13H,3,14H2,1-2H3,(H,28,30)/b27-13+ |
| InChIKey | PCHFUCSJNRZESO-UVHMKAGCSA-N |
| XLogP | 5.87 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.26 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|