C27H21ClN2O3S2 — CID 126336181
2-[[2-chloro-4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126336181) has the molecular formula C27H21ClN2O3S2 and a molecular weight of 521.06 g/mol. Its IUPAC name is 2-[[2-chloro-4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-chloro-4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126336181 |
| Molecular Formula | C27H21ClN2O3S2 |
| Molecular Weight | 521.06 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 2-[[2-chloro-4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3ccc(C)cc3C)C2=O)cc(Cl)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H21ClN2O3S2/c1-16-8-9-22(17(2)10-16)30-26(31)24(35-27(30)34)13-18-11-21(28)25(23(12-18)32-3)33-15-20-7-5-4-6-19(20)14-29/h4-13H,15H2,1-3H3/b24-13+ |
| InChIKey | JDKNETPFISKDRI-ZMOGYAJESA-N |
| XLogP | 6.82 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.06 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|