C26H21ClN4O5S2 — CID 126338624
N-[2-[(2-chloro-6-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-2-(morpholine-4-carbonyl)benzamide (PubChem CID 126338624) has the molecular formula C26H21ClN4O5S2 and a molecular weight of 569.06 g/mol. Its IUPAC name is N-[2-[(2-chloro-6-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-2-(morpholine-4-carbonyl)benzamide.
| Compound Name | N-[2-[(2-chloro-6-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-2-(morpholine-4-carbonyl)benzamide |
|---|---|
| PubChem CID | 126338624 |
| Molecular Formula | C26H21ClN4O5S2 |
| Molecular Weight | 569.06 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | N-[2-[(2-chloro-6-nitrophenyl)methylsulfanyl]-1,3-benzothiazol-6-yl]-2-(morpholine-4-carbonyl)benzamide |
| SMILES | O=C(Nc1ccc2nc(SCc3c(Cl)cccc3[N+](=O)[O-])sc2c1)c1ccccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H21ClN4O5S2/c27-20-6-3-7-22(31(34)35)19(20)15-37-26-29-21-9-8-16(14-23(21)38-26)28-24(32)17-4-1-2-5-18(17)25(33)30-10-12-36-13-11-30/h1-9,14H,10-13,15H2,(H,28,32) |
| InChIKey | FUIVYUUVWVHMLJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.06 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|