C21H18N4O7 — CID 126375443
(E)-3-[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile (PubChem CID 126375443) has the molecular formula C21H18N4O7 and a molecular weight of 438.40 g/mol. Its IUPAC name is (E)-3-[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126375443 |
| Molecular Formula | C21H18N4O7 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (E)-3-[2-(2,4-dinitrophenoxy)-3-methoxyphenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
| SMILES | COc1cccc(/C=C(\C#N)C(=O)N2CCCC2)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H18N4O7/c1-31-19-6-4-5-14(11-15(13-22)21(26)23-9-2-3-10-23)20(19)32-18-8-7-16(24(27)28)12-17(18)25(29)30/h4-8,11-12H,2-3,9-10H2,1H3/b15-11+ |
| InChIKey | BHUJLPBUJKAUDM-RVDMUPIBSA-N |
| XLogP | 3.83 |
| TPSA | 148.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|