C25H15Cl3FN3O4S — CID 126386547
2-[2-chloro-4-[(E)-[1-(2,3-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126386547) has the molecular formula C25H15Cl3FN3O4S and a molecular weight of 578.84 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-[1-(2,3-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(E)-[1-(2,3-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126386547 |
| Molecular Formula | C25H15Cl3FN3O4S |
| Molecular Weight | 578.84 g/mol |
| Exact Mass | 576.98 |
| IUPAC Name | 2-[2-chloro-4-[(E)-[1-(2,3-dichlorophenyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]phenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(COc1ccc(/C=C2\C(=O)NC(=S)N(c3cccc(Cl)c3Cl)C2=O)cc1Cl)Nc1ccccc1F |
| InChI | InChI=1S/C25H15Cl3FN3O4S/c26-15-4-3-7-19(22(15)28)32-24(35)14(23(34)31-25(32)37)10-13-8-9-20(16(27)11-13)36-12-21(33)30-18-6-2-1-5-17(18)29/h1-11H,12H2,(H,30,33)(H,31,34,37)/b14-10+ |
| InChIKey | JIXWZBJFGAVZHJ-GXDHUFHOSA-N |
| XLogP | 5.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.84 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|