C27H41N3O3 — CID 126418485
(2R,3S)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanamide (PubChem CID 126418485) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is (2R,3S)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanamide.
| Compound Name | (2R,3S)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanamide |
|---|---|
| PubChem CID | 126418485 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | (2R,3S)-N-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N-(2-methoxyethyl)-3-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanamide |
| SMILES | CC[C@H](C)[C@H](C(=O)N(CCOC)C[C@@H]1CCCN2CCCC[C@H]12)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C27H41N3O3/c1-4-20(2)25(30-19-21-10-5-6-12-23(21)26(30)31)27(32)29(16-17-33-3)18-22-11-9-15-28-14-8-7-13-24(22)28/h5-6,10,12,20,22,24-25H,4,7-9,11,13-19H2,1-3H3/t20-,22-,24+,25+/m0/s1 |
| InChIKey | XYBSMJKCXSZSFX-MMTHZHQFSA-N |
| XLogP | 3.80 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |