C16H26N4OS — CID 126426357
4-[5-[[(2S)-oxan-2-yl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidine (PubChem CID 126426357) has the molecular formula C16H26N4OS and a molecular weight of 322.48 g/mol. Its IUPAC name is 4-[5-[[(2S)-oxan-2-yl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidine.
| Compound Name | 4-[5-[[(2S)-oxan-2-yl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidine |
|---|---|
| PubChem CID | 126426357 |
| Molecular Formula | C16H26N4OS |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-[5-[[(2S)-oxan-2-yl]methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidine |
| SMILES | C=CCn1c(SC[C@@H]2CCCCO2)nnc1C1CCNCC1 |
| InChI | InChI=1S/C16H26N4OS/c1-2-10-20-15(13-6-8-17-9-7-13)18-19-16(20)22-12-14-5-3-4-11-21-14/h2,13-14,17H,1,3-12H2/t14-/m0/s1 |
| InChIKey | OGVDMPDDWRTMGW-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|