C16H27ClN4OS — CID 154906233
4-[5-[2-(oxolan-3-yl)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidine;hydrochloride (PubChem CID 154906233) has the molecular formula C16H27ClN4OS and a molecular weight of 358.94 g/mol. Its IUPAC name is 4-[5-[2-(oxolan-3-yl)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidine;hydrochloride.
| Compound Name | 4-[5-[2-(oxolan-3-yl)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 154906233 |
| Molecular Formula | C16H27ClN4OS |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-[5-[2-(oxolan-3-yl)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]piperidine;hydrochloride |
| SMILES | C=CCn1c(SCCC2CCOC2)nnc1C1CCNCC1.Cl |
| InChI | InChI=1S/C16H26N4OS.ClH/c1-2-9-20-15(14-3-7-17-8-4-14)18-19-16(20)22-11-6-13-5-10-21-12-13;/h2,13-14,17H,1,3-12H2;1H |
| InChIKey | HGZSAVINJMYWHM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|