C16H26N4O2S2 — CID 126449740
(3R)-3-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]thiane 1,1-dioxide (PubChem CID 126449740) has the molecular formula C16H26N4O2S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (3R)-3-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]thiane 1,1-dioxide.
| Compound Name | (3R)-3-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 126449740 |
| Molecular Formula | C16H26N4O2S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (3R)-3-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]thiane 1,1-dioxide |
| SMILES | C=CCn1c(SC[C@H]2CCCS(=O)(=O)C2)nnc1C1CCNCC1 |
| InChI | InChI=1S/C16H26N4O2S2/c1-2-9-20-15(14-5-7-17-8-6-14)18-19-16(20)23-11-13-4-3-10-24(21,22)12-13/h2,13-14,17H,1,3-12H2/t13-/m1/s1 |
| InChIKey | PYSZGUBIVAYRJY-CYBMUJFWSA-N |
| XLogP | 1.85 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|