C17H20FN3OS — CID 126444900
(2R)-2-(4-fluorophenyl)-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]azetidine-1-carboxamide (PubChem CID 126444900) has the molecular formula C17H20FN3OS and a molecular weight of 333.43 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]azetidine-1-carboxamide.
| Compound Name | (2R)-2-(4-fluorophenyl)-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 126444900 |
| Molecular Formula | C17H20FN3OS |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-N-[3-(4-methyl-1,3-thiazol-5-yl)propyl]azetidine-1-carboxamide |
| SMILES | Cc1ncsc1CCCNC(=O)N1CC[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN3OS/c1-12-16(23-11-20-12)3-2-9-19-17(22)21-10-8-15(21)13-4-6-14(18)7-5-13/h4-7,11,15H,2-3,8-10H2,1H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | FGOAKGCQUNPQAB-OAHLLOKOSA-N |
| XLogP | 3.68 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|