C19H23FN2O3 — CID 126445655
(2R)-N-[2-(2-fluorophenoxy)ethyl]-2-(furan-2-yl)azepane-1-carboxamide (PubChem CID 126445655) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is (2R)-N-[2-(2-fluorophenoxy)ethyl]-2-(furan-2-yl)azepane-1-carboxamide.
| Compound Name | (2R)-N-[2-(2-fluorophenoxy)ethyl]-2-(furan-2-yl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 126445655 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (2R)-N-[2-(2-fluorophenoxy)ethyl]-2-(furan-2-yl)azepane-1-carboxamide |
| SMILES | O=C(NCCOc1ccccc1F)N1CCCCC[C@@H]1c1ccco1 |
| InChI | InChI=1S/C19H23FN2O3/c20-15-7-3-4-9-17(15)25-14-11-21-19(23)22-12-5-1-2-8-16(22)18-10-6-13-24-18/h3-4,6-7,9-10,13,16H,1-2,5,8,11-12,14H2,(H,21,23)/t16-/m1/s1 |
| InChIKey | GMIITBAJTAANRI-MRXNPFEDSA-N |
| XLogP | 4.12 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|